C10H10F3N5 — CID 114566044
N-ethyl-4-pyrazol-1-yl-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 114566044) has the molecular formula C10H10F3N5 and a molecular weight of 257.22 g/mol. Its IUPAC name is N-ethyl-4-pyrazol-1-yl-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-ethyl-4-pyrazol-1-yl-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 114566044 |
| Molecular Formula | C10H10F3N5 |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | N-ethyl-4-pyrazol-1-yl-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CCNc1nc(-n2cccn2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H10F3N5/c1-2-14-9-16-7(10(11,12)13)6-8(17-9)18-5-3-4-15-18/h3-6H,2H2,1H3,(H,14,16,17) |
| InChIKey | DXHLAOWZJNKCJT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |