C13H20F3N3O — CID 114566168
4-(2-methylbutan-2-yloxy)-N-propyl-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 114566168) has the molecular formula C13H20F3N3O and a molecular weight of 291.32 g/mol. Its IUPAC name is 4-(2-methylbutan-2-yloxy)-N-propyl-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-(2-methylbutan-2-yloxy)-N-propyl-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 114566168 |
| Molecular Formula | C13H20F3N3O |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 4-(2-methylbutan-2-yloxy)-N-propyl-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CCCNc1nc(OC(C)(C)CC)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H20F3N3O/c1-5-7-17-11-18-9(13(14,15)16)8-10(19-11)20-12(3,4)6-2/h8H,5-7H2,1-4H3,(H,17,18,19) |
| InChIKey | JWHDWBJMCMDKNF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |