C11H13N3O — CID 105455342
4-ethyl-8-methoxyquinazolin-2-amine (PubChem CID 105455342) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 4-ethyl-8-methoxyquinazolin-2-amine.
| Compound Name | 4-ethyl-8-methoxyquinazolin-2-amine |
|---|---|
| PubChem CID | 105455342 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 4-ethyl-8-methoxyquinazolin-2-amine |
| SMILES | CCc1nc(N)nc2c(OC)cccc12 |
| InChI | InChI=1S/C11H13N3O/c1-3-8-7-5-4-6-9(15-2)10(7)14-11(12)13-8/h4-6H,3H2,1-2H3,(H2,12,13,14) |
| InChIKey | PXYXNSDSCKANDV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |