C14H19N5O3 — CID 174215466
(3R)-N-(2-amino-8-methoxyquinazolin-4-yl)-3-hydroxypentanehydrazide (PubChem CID 174215466) has the molecular formula C14H19N5O3 and a molecular weight of 305.34 g/mol. Its IUPAC name is (3R)-N-(2-amino-8-methoxyquinazolin-4-yl)-3-hydroxypentanehydrazide.
| Compound Name | (3R)-N-(2-amino-8-methoxyquinazolin-4-yl)-3-hydroxypentanehydrazide |
|---|---|
| PubChem CID | 174215466 |
| Molecular Formula | C14H19N5O3 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | (3R)-N-(2-amino-8-methoxyquinazolin-4-yl)-3-hydroxypentanehydrazide |
| SMILES | CC[C@@H](O)CC(=O)N(N)c1nc(N)nc2c(OC)cccc12 |
| InChI | InChI=1S/C14H19N5O3/c1-3-8(20)7-11(21)19(16)13-9-5-4-6-10(22-2)12(9)17-14(15)18-13/h4-6,8,20H,3,7,16H2,1-2H3,(H2,15,17,18)/t8-/m1/s1 |
| InChIKey | JJPGKRYYJJLTAJ-MRVPVSSYSA-N |
| XLogP | 0.59 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|