C13H15ClN4O3 — CID 90259926
N'-(2-chloro-8-methoxyquinazolin-4-yl)-3-hydroxybutanehydrazide (PubChem CID 90259926) has the molecular formula C13H15ClN4O3 and a molecular weight of 310.74 g/mol. Its IUPAC name is N'-(2-chloro-8-methoxyquinazolin-4-yl)-3-hydroxybutanehydrazide.
| Compound Name | N'-(2-chloro-8-methoxyquinazolin-4-yl)-3-hydroxybutanehydrazide |
|---|---|
| PubChem CID | 90259926 |
| Molecular Formula | C13H15ClN4O3 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | N'-(2-chloro-8-methoxyquinazolin-4-yl)-3-hydroxybutanehydrazide |
| SMILES | COc1cccc2c(NNC(=O)CC(C)O)nc(Cl)nc12 |
| InChI | InChI=1S/C13H15ClN4O3/c1-7(19)6-10(20)17-18-12-8-4-3-5-9(21-2)11(8)15-13(14)16-12/h3-5,7,19H,6H2,1-2H3,(H,17,20)(H,15,16,18) |
| InChIKey | GROALUHPRNKUDC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|