C19H27N7O7 — CID 159467255
ethyl 3-[2-(2-amino-8-methoxyquinazolin-4-yl)hydrazinyl]-3-oxopropanoate;ethyl 3-hydrazinyl-3-oxopropanoate (PubChem CID 159467255) has the molecular formula C19H27N7O7 and a molecular weight of 465.47 g/mol. Its IUPAC name is ethyl 3-[2-(2-amino-8-methoxyquinazolin-4-yl)hydrazinyl]-3-oxopropanoate;ethyl 3-hydrazinyl-3-oxopropanoate.
| Compound Name | ethyl 3-[2-(2-amino-8-methoxyquinazolin-4-yl)hydrazinyl]-3-oxopropanoate;ethyl 3-hydrazinyl-3-oxopropanoate |
|---|---|
| PubChem CID | 159467255 |
| Molecular Formula | C19H27N7O7 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | ethyl 3-[2-(2-amino-8-methoxyquinazolin-4-yl)hydrazinyl]-3-oxopropanoate;ethyl 3-hydrazinyl-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)NN.CCOC(=O)CC(=O)NNc1nc(N)nc2c(OC)cccc12 |
| InChI | InChI=1S/C14H17N5O4.C5H10N2O3/c1-3-23-11(21)7-10(20)18-19-13-8-5-4-6-9(22-2)12(8)16-14(15)17-13;1-2-10-5(9)3-4(8)7-6/h4-6H,3,7H2,1-2H3,(H,18,20)(H3,15,16,17,19);2-3,6H2,1H3,(H,7,8) |
| InChIKey | LVIQPHAYLZDUHF-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 209.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|