C17H19NO6 — CID 23657158
ethyl 3-oxo-3-(5,6,8-trimethoxyquinolin-2-yl)propanoate (PubChem CID 23657158) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is ethyl 3-oxo-3-(5,6,8-trimethoxyquinolin-2-yl)propanoate.
| Compound Name | ethyl 3-oxo-3-(5,6,8-trimethoxyquinolin-2-yl)propanoate |
|---|---|
| PubChem CID | 23657158 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | ethyl 3-oxo-3-(5,6,8-trimethoxyquinolin-2-yl)propanoate |
| SMILES | CCOC(=O)CC(=O)c1ccc2c(OC)c(OC)cc(OC)c2n1 |
| InChI | InChI=1S/C17H19NO6/c1-5-24-15(20)8-12(19)11-7-6-10-16(18-11)13(21-2)9-14(22-3)17(10)23-4/h6-7,9H,5,8H2,1-4H3 |
| InChIKey | DYOOREKYRLFZNX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|