C12H13ClN4O2 — CID 22693205
N'-(2-chloroquinazolin-4-yl)-3-methoxypropanehydrazide (PubChem CID 22693205) has the molecular formula C12H13ClN4O2 and a molecular weight of 280.72 g/mol. Its IUPAC name is N'-(2-chloroquinazolin-4-yl)-3-methoxypropanehydrazide.
| Compound Name | N'-(2-chloroquinazolin-4-yl)-3-methoxypropanehydrazide |
|---|---|
| PubChem CID | 22693205 |
| Molecular Formula | C12H13ClN4O2 |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | N'-(2-chloroquinazolin-4-yl)-3-methoxypropanehydrazide |
| SMILES | COCCC(=O)NNc1nc(Cl)nc2ccccc12 |
| InChI | InChI=1S/C12H13ClN4O2/c1-19-7-6-10(18)16-17-11-8-4-2-3-5-9(8)14-12(13)15-11/h2-5H,6-7H2,1H3,(H,16,18)(H,14,15,17) |
| InChIKey | KYYKPRKEJCPYSX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|