C14H14ClF3N2 — CID 63744425
8-chloro-3-methyl-N-propyl-2-(trifluoromethyl)quinolin-4-amine (PubChem CID 63744425) has the molecular formula C14H14ClF3N2 and a molecular weight of 302.73 g/mol. Its IUPAC name is 8-chloro-3-methyl-N-propyl-2-(trifluoromethyl)quinolin-4-amine.
| Compound Name | 8-chloro-3-methyl-N-propyl-2-(trifluoromethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 63744425 |
| Molecular Formula | C14H14ClF3N2 |
| Molecular Weight | 302.73 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 8-chloro-3-methyl-N-propyl-2-(trifluoromethyl)quinolin-4-amine |
| SMILES | CCCNc1c(C)c(C(F)(F)F)nc2c(Cl)cccc12 |
| InChI | InChI=1S/C14H14ClF3N2/c1-3-7-19-11-8(2)13(14(16,17)18)20-12-9(11)5-4-6-10(12)15/h4-6H,3,7H2,1-2H3,(H,19,20) |
| InChIKey | PHSYIDCJHVVHKA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.73 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |