C13H15Cl2N3 — CID 63482793
(2-tert-butyl-6,8-dichloroquinolin-4-yl)hydrazine (PubChem CID 63482793) has the molecular formula C13H15Cl2N3 and a molecular weight of 284.19 g/mol. Its IUPAC name is (2-tert-butyl-6,8-dichloroquinolin-4-yl)hydrazine.
| Compound Name | (2-tert-butyl-6,8-dichloroquinolin-4-yl)hydrazine |
|---|---|
| PubChem CID | 63482793 |
| Molecular Formula | C13H15Cl2N3 |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | (2-tert-butyl-6,8-dichloroquinolin-4-yl)hydrazine |
| SMILES | CC(C)(C)c1cc(NN)c2cc(Cl)cc(Cl)c2n1 |
| InChI | InChI=1S/C13H15Cl2N3/c1-13(2,3)11-6-10(18-16)8-4-7(14)5-9(15)12(8)17-11/h4-6H,16H2,1-3H3,(H,17,18) |
| InChIKey | XXQVJQFPRMIFQK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|