C15H17N3 — CID 62189896
7,8-dimethyl-4-(propylamino)quinoline-3-carbonitrile (PubChem CID 62189896) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 7,8-dimethyl-4-(propylamino)quinoline-3-carbonitrile.
| Compound Name | 7,8-dimethyl-4-(propylamino)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 62189896 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 7,8-dimethyl-4-(propylamino)quinoline-3-carbonitrile |
| SMILES | CCCNc1c(C#N)cnc2c(C)c(C)ccc12 |
| InChI | InChI=1S/C15H17N3/c1-4-7-17-15-12(8-16)9-18-14-11(3)10(2)5-6-13(14)15/h5-6,9H,4,7H2,1-3H3,(H,17,18) |
| InChIKey | LOGNNCHPKYDNAB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |