C14H19N5OS — CID 71940540
N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-1,4-thiazepane-4-carboxamide (PubChem CID 71940540) has the molecular formula C14H19N5OS and a molecular weight of 305.41 g/mol. Its IUPAC name is N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-1,4-thiazepane-4-carboxamide.
| Compound Name | N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 71940540 |
| Molecular Formula | C14H19N5OS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-1,4-thiazepane-4-carboxamide |
| SMILES | N#Cc1cccnc1NCCNC(=O)N1CCCSCC1 |
| InChI | InChI=1S/C14H19N5OS/c15-11-12-3-1-4-16-13(12)17-5-6-18-14(20)19-7-2-9-21-10-8-19/h1,3-4H,2,5-10H2,(H,16,17)(H,18,20) |
| InChIKey | CSAXJBPJEXGJGL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|