C17H17F2N5O — CID 47066721
1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-[2-(2,6-difluorophenyl)ethyl]urea (PubChem CID 47066721) has the molecular formula C17H17F2N5O and a molecular weight of 345.35 g/mol. Its IUPAC name is 1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-[2-(2,6-difluorophenyl)ethyl]urea.
| Compound Name | 1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-[2-(2,6-difluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 47066721 |
| Molecular Formula | C17H17F2N5O |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-[2-(2,6-difluorophenyl)ethyl]urea |
| SMILES | N#Cc1cccnc1NCCNC(=O)NCCc1c(F)cccc1F |
| InChI | InChI=1S/C17H17F2N5O/c18-14-4-1-5-15(19)13(14)6-8-23-17(25)24-10-9-22-16-12(11-20)3-2-7-21-16/h1-5,7H,6,8-10H2,(H,21,22)(H2,23,24,25) |
| InChIKey | ZDMQRISHGOXXNI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|