C20H21N7O — CID 55793521
1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-[2-(1-phenylpyrazol-4-yl)ethyl]urea (PubChem CID 55793521) has the molecular formula C20H21N7O and a molecular weight of 375.44 g/mol. Its IUPAC name is 1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-[2-(1-phenylpyrazol-4-yl)ethyl]urea.
| Compound Name | 1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-[2-(1-phenylpyrazol-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 55793521 |
| Molecular Formula | C20H21N7O |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-[2-(1-phenylpyrazol-4-yl)ethyl]urea |
| SMILES | N#Cc1cccnc1NCCNC(=O)NCCc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C20H21N7O/c21-13-17-5-4-9-22-19(17)23-11-12-25-20(28)24-10-8-16-14-26-27(15-16)18-6-2-1-3-7-18/h1-7,9,14-15H,8,10-12H2,(H,22,23)(H2,24,25,28) |
| InChIKey | RVSKIQAPEQQMOJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 107.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|