C20H17FN6O2 — CID 55743637
1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-[6-(4-fluorophenoxy)-3-pyridinyl]urea (PubChem CID 55743637) has the molecular formula C20H17FN6O2 and a molecular weight of 392.39 g/mol. Its IUPAC name is 1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-[6-(4-fluorophenoxy)-3-pyridinyl]urea.
| Compound Name | 1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-[6-(4-fluorophenoxy)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 55743637 |
| Molecular Formula | C20H17FN6O2 |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-[6-(4-fluorophenoxy)-3-pyridinyl]urea |
| SMILES | N#Cc1cccnc1NCCNC(=O)Nc1ccc(Oc2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C20H17FN6O2/c21-15-3-6-17(7-4-15)29-18-8-5-16(13-26-18)27-20(28)25-11-10-24-19-14(12-22)2-1-9-23-19/h1-9,13H,10-11H2,(H,23,24)(H2,25,27,28) |
| InChIKey | FBDOELMMVIPARA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|