C12H15N3S — CID 115625296
2-(thian-4-ylmethylamino)pyridine-3-carbonitrile (PubChem CID 115625296) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is 2-(thian-4-ylmethylamino)pyridine-3-carbonitrile.
| Compound Name | 2-(thian-4-ylmethylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 115625296 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 2-(thian-4-ylmethylamino)pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1NCC1CCSCC1 |
| InChI | InChI=1S/C12H15N3S/c13-8-11-2-1-5-14-12(11)15-9-10-3-6-16-7-4-10/h1-2,5,10H,3-4,6-7,9H2,(H,14,15) |
| InChIKey | QCZBLQQZPHAKTR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |