C17H20N4S — CID 49227412
2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methylamino]pyridine-3-carbonitrile (PubChem CID 49227412) has the molecular formula C17H20N4S and a molecular weight of 312.44 g/mol. Its IUPAC name is 2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methylamino]pyridine-3-carbonitrile.
| Compound Name | 2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 49227412 |
| Molecular Formula | C17H20N4S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methylamino]pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1NCC1CCCN(Cc2cccs2)C1 |
| InChI | InChI=1S/C17H20N4S/c18-10-15-5-1-7-19-17(15)20-11-14-4-2-8-21(12-14)13-16-6-3-9-22-16/h1,3,5-7,9,14H,2,4,8,11-13H2,(H,19,20) |
| InChIKey | SKQNHAWNUAFRRQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |