C19H32N4S — CID 110957380
1-cyclohexyl-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine (PubChem CID 110957380) has the molecular formula C19H32N4S and a molecular weight of 348.56 g/mol. Its IUPAC name is 1-cyclohexyl-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine.
| Compound Name | 1-cyclohexyl-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 110957380 |
| Molecular Formula | C19H32N4S |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 1-cyclohexyl-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine |
| SMILES | C/N=C(\NCC1CCCN(Cc2cccs2)C1)NC1CCCCC1 |
| InChI | InChI=1S/C19H32N4S/c1-20-19(22-17-8-3-2-4-9-17)21-13-16-7-5-11-23(14-16)15-18-10-6-12-24-18/h6,10,12,16-17H,2-5,7-9,11,13-15H2,1H3,(H2,20,21,22) |
| InChIKey | KZWOUDFEQWTXNG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|