C20H30N4S2 — CID 111957331
1-[(5-ethylthiophen-2-yl)methyl]-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine (PubChem CID 111957331) has the molecular formula C20H30N4S2 and a molecular weight of 390.62 g/mol. Its IUPAC name is 1-[(5-ethylthiophen-2-yl)methyl]-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine.
| Compound Name | 1-[(5-ethylthiophen-2-yl)methyl]-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111957331 |
| Molecular Formula | C20H30N4S2 |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-[(5-ethylthiophen-2-yl)methyl]-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine |
| SMILES | CCc1ccc(CN/C(=N\C)NCC2CCCN(Cc3cccs3)C2)s1 |
| InChI | InChI=1S/C20H30N4S2/c1-3-17-8-9-18(26-17)13-23-20(21-2)22-12-16-6-4-10-24(14-16)15-19-7-5-11-25-19/h5,7-9,11,16H,3-4,6,10,12-15H2,1-2H3,(H2,21,22,23) |
| InChIKey | ICPDRPCZBQHNDV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|