C21H36N4OS2 — CID 109438413
1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine (PubChem CID 109438413) has the molecular formula C21H36N4OS2 and a molecular weight of 424.68 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 109438413 |
| Molecular Formula | C21H36N4OS2 |
| Molecular Weight | 424.68 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCC2CCCN(Cc3cccs3)C2)C1 |
| InChI | InChI=1S/C21H36N4OS2/c1-3-28(26)20-10-4-8-18(13-20)24-21(22-2)23-14-17-7-5-11-25(15-17)16-19-9-6-12-27-19/h6,9,12,17-18,20H,3-5,7-8,10-11,13-16H2,1-2H3,(H2,22,23,24) |
| InChIKey | CNCFFHVLZSDXJU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.68 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|