C24H36IN5S — CID 111923356
2-methyl-1-[1-(4-methylphenyl)pyrrolidin-3-yl]-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine;hydroiodide (PubChem CID 111923356) has the molecular formula C24H36IN5S and a molecular weight of 553.56 g/mol. Its IUPAC name is 2-methyl-1-[1-(4-methylphenyl)pyrrolidin-3-yl]-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[1-(4-methylphenyl)pyrrolidin-3-yl]-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111923356 |
| Molecular Formula | C24H36IN5S |
| Molecular Weight | 553.56 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | 2-methyl-1-[1-(4-methylphenyl)pyrrolidin-3-yl]-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCCN(Cc2cccs2)C1)NC1CCN(c2ccc(C)cc2)C1.I |
| InChI | InChI=1S/C24H35N5S.HI/c1-19-7-9-22(10-8-19)29-13-11-21(17-29)27-24(25-2)26-15-20-5-3-12-28(16-20)18-23-6-4-14-30-23;/h4,6-10,14,20-21H,3,5,11-13,15-18H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | VPMXVPHRRVZQIZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|