C21H39IN4OS — CID 111718091
1-(3-ethoxy-4-methylpentyl)-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine;hydroiodide (PubChem CID 111718091) has the molecular formula C21H39IN4OS and a molecular weight of 522.54 g/mol. Its IUPAC name is 1-(3-ethoxy-4-methylpentyl)-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-ethoxy-4-methylpentyl)-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111718091 |
| Molecular Formula | C21H39IN4OS |
| Molecular Weight | 522.54 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 1-(3-ethoxy-4-methylpentyl)-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine;hydroiodide |
| SMILES | CCOC(CCN/C(=N\C)NCC1CCCN(Cc2cccs2)C1)C(C)C.I |
| InChI | InChI=1S/C21H38N4OS.HI/c1-5-26-20(17(2)3)10-11-23-21(22-4)24-14-18-8-6-12-25(15-18)16-19-9-7-13-27-19;/h7,9,13,17-18,20H,5-6,8,10-12,14-16H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | BMNATSBMGGILBM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|