C19H18BrN5O — CID 55858166
2-(3-bromo-2-methylindol-1-yl)-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]acetamide (PubChem CID 55858166) has the molecular formula C19H18BrN5O and a molecular weight of 412.29 g/mol. Its IUPAC name is 2-(3-bromo-2-methylindol-1-yl)-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]acetamide.
| Compound Name | 2-(3-bromo-2-methylindol-1-yl)-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 55858166 |
| Molecular Formula | C19H18BrN5O |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 2-(3-bromo-2-methylindol-1-yl)-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]acetamide |
| SMILES | Cc1c(Br)c2ccccc2n1CC(=O)NCCNc1ncccc1C#N |
| InChI | InChI=1S/C19H18BrN5O/c1-13-18(20)15-6-2-3-7-16(15)25(13)12-17(26)22-9-10-24-19-14(11-21)5-4-8-23-19/h2-8H,9-10,12H2,1H3,(H,22,26)(H,23,24) |
| InChIKey | QGWDMRAHQDTLPB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|