C20H22BrN3O3S — CID 55859179
2-(3-bromo-2-methylindol-1-yl)-N-[[2-(dimethylsulfamoyl)phenyl]methyl]acetamide (PubChem CID 55859179) has the molecular formula C20H22BrN3O3S and a molecular weight of 464.39 g/mol. Its IUPAC name is 2-(3-bromo-2-methylindol-1-yl)-N-[[2-(dimethylsulfamoyl)phenyl]methyl]acetamide.
| Compound Name | 2-(3-bromo-2-methylindol-1-yl)-N-[[2-(dimethylsulfamoyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 55859179 |
| Molecular Formula | C20H22BrN3O3S |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | 2-(3-bromo-2-methylindol-1-yl)-N-[[2-(dimethylsulfamoyl)phenyl]methyl]acetamide |
| SMILES | Cc1c(Br)c2ccccc2n1CC(=O)NCc1ccccc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C20H22BrN3O3S/c1-14-20(21)16-9-5-6-10-17(16)24(14)13-19(25)22-12-15-8-4-7-11-18(15)28(26,27)23(2)3/h4-11H,12-13H2,1-3H3,(H,22,25) |
| InChIKey | RGPUZUVLRPWYGQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |