C13H15BrN4O2 — CID 47383615
1-[[2-(3-bromo-2-methylindol-1-yl)acetyl]amino]-3-methylurea (PubChem CID 47383615) has the molecular formula C13H15BrN4O2 and a molecular weight of 339.19 g/mol. Its IUPAC name is 1-[[2-(3-bromo-2-methylindol-1-yl)acetyl]amino]-3-methylurea.
| Compound Name | 1-[[2-(3-bromo-2-methylindol-1-yl)acetyl]amino]-3-methylurea |
|---|---|
| PubChem CID | 47383615 |
| Molecular Formula | C13H15BrN4O2 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 1-[[2-(3-bromo-2-methylindol-1-yl)acetyl]amino]-3-methylurea |
| SMILES | CNC(=O)NNC(=O)Cn1c(C)c(Br)c2ccccc21 |
| InChI | InChI=1S/C13H15BrN4O2/c1-8-12(14)9-5-3-4-6-10(9)18(8)7-11(19)16-17-13(20)15-2/h3-6H,7H2,1-2H3,(H,16,19)(H2,15,17,20) |
| InChIKey | HMDFDZHYRPVMRN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 75.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|