C18H18BrN3O3S — CID 52714750
2-(3-bromo-2-methylindol-1-yl)-N-[2-(methanesulfonamido)phenyl]acetamide (PubChem CID 52714750) has the molecular formula C18H18BrN3O3S and a molecular weight of 436.33 g/mol. Its IUPAC name is 2-(3-bromo-2-methylindol-1-yl)-N-[2-(methanesulfonamido)phenyl]acetamide.
| Compound Name | 2-(3-bromo-2-methylindol-1-yl)-N-[2-(methanesulfonamido)phenyl]acetamide |
|---|---|
| PubChem CID | 52714750 |
| Molecular Formula | C18H18BrN3O3S |
| Molecular Weight | 436.33 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | 2-(3-bromo-2-methylindol-1-yl)-N-[2-(methanesulfonamido)phenyl]acetamide |
| SMILES | Cc1c(Br)c2ccccc2n1CC(=O)Nc1ccccc1NS(C)(=O)=O |
| InChI | InChI=1S/C18H18BrN3O3S/c1-12-18(19)13-7-3-6-10-16(13)22(12)11-17(23)20-14-8-4-5-9-15(14)21-26(2,24)25/h3-10,21H,11H2,1-2H3,(H,20,23) |
| InChIKey | SJVXEVRPFLYOCG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |