C20H20N2O2 — CID 965806
N-(2,3-dimethylphenyl)-2-(3-formyl-2-methylindol-1-yl)acetamide (PubChem CID 965806) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-(3-formyl-2-methylindol-1-yl)acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-(3-formyl-2-methylindol-1-yl)acetamide |
|---|---|
| PubChem CID | 965806 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-(3-formyl-2-methylindol-1-yl)acetamide |
| SMILES | Cc1cccc(NC(=O)Cn2c(C)c(C=O)c3ccccc32)c1C |
| InChI | InChI=1S/C20H20N2O2/c1-13-7-6-9-18(14(13)2)21-20(24)11-22-15(3)17(12-23)16-8-4-5-10-19(16)22/h4-10,12H,11H2,1-3H3,(H,21,24) |
| InChIKey | UOJQKXCMNCVLML-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|