C12H10NO3- — CID 5175467
2-(3-formyl-2-methylindol-1-yl)acetate (PubChem CID 5175467) has the molecular formula C12H10NO3- and a molecular weight of 216.22 g/mol. Its IUPAC name is 2-(3-formyl-2-methylindol-1-yl)acetate.
| Compound Name | 2-(3-formyl-2-methylindol-1-yl)acetate |
|---|---|
| PubChem CID | 5175467 |
| Molecular Formula | C12H10NO3- |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 2-(3-formyl-2-methylindol-1-yl)acetate |
| SMILES | Cc1c(C=O)c2ccccc2n1CC(=O)[O-] |
| InChI | InChI=1S/C12H11NO3/c1-8-10(7-14)9-4-2-3-5-11(9)13(8)6-12(15)16/h2-5,7H,6H2,1H3,(H,15,16)/p-1 |
| InChIKey | SPDRKMLFDFIREG-UHFFFAOYSA-M |
| XLogP | 0.51 |
| TPSA | 62.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|