C19H19BrN2O4S — CID 52661626
2-(3-bromo-2-methylindol-1-yl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)acetamide (PubChem CID 52661626) has the molecular formula C19H19BrN2O4S and a molecular weight of 451.34 g/mol. Its IUPAC name is 2-(3-bromo-2-methylindol-1-yl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)acetamide.
| Compound Name | 2-(3-bromo-2-methylindol-1-yl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 52661626 |
| Molecular Formula | C19H19BrN2O4S |
| Molecular Weight | 451.34 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 2-(3-bromo-2-methylindol-1-yl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)acetamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)Cn2c(C)c(Br)c3ccccc32)c1 |
| InChI | InChI=1S/C19H19BrN2O4S/c1-3-27(25,26)13-8-9-17(23)15(10-13)21-18(24)11-22-12(2)19(20)14-6-4-5-7-16(14)22/h4-10,23H,3,11H2,1-2H3,(H,21,24) |
| InChIKey | RAHDYQXBPFGFBU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|