C14H16BrN3O4S — CID 19517975
2-(4-bromo-5-methylpyrazol-1-yl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)acetamide (PubChem CID 19517975) has the molecular formula C14H16BrN3O4S and a molecular weight of 402.27 g/mol. Its IUPAC name is 2-(4-bromo-5-methylpyrazol-1-yl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)acetamide.
| Compound Name | 2-(4-bromo-5-methylpyrazol-1-yl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 19517975 |
| Molecular Formula | C14H16BrN3O4S |
| Molecular Weight | 402.27 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | 2-(4-bromo-5-methylpyrazol-1-yl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)acetamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)Cn2ncc(Br)c2C)c1 |
| InChI | InChI=1S/C14H16BrN3O4S/c1-3-23(21,22)10-4-5-13(19)12(6-10)17-14(20)8-18-9(2)11(15)7-16-18/h4-7,19H,3,8H2,1-2H3,(H,17,20) |
| InChIKey | DOZNDMDDVIPDRU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|