C16H17BrF3N3O4S — CID 19551944
3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(5-ethylsulfonyl-2-hydroxyphenyl)propanamide (PubChem CID 19551944) has the molecular formula C16H17BrF3N3O4S and a molecular weight of 484.29 g/mol. Its IUPAC name is 3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(5-ethylsulfonyl-2-hydroxyphenyl)propanamide.
| Compound Name | 3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(5-ethylsulfonyl-2-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 19551944 |
| Molecular Formula | C16H17BrF3N3O4S |
| Molecular Weight | 484.29 g/mol |
| Exact Mass | 483.01 |
| IUPAC Name | 3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(5-ethylsulfonyl-2-hydroxyphenyl)propanamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)CCn2nc(C(F)(F)F)c(Br)c2C)c1 |
| InChI | InChI=1S/C16H17BrF3N3O4S/c1-3-28(26,27)10-4-5-12(24)11(8-10)21-13(25)6-7-23-9(2)14(17)15(22-23)16(18,19)20/h4-5,8,24H,3,6-7H2,1-2H3,(H,21,25) |
| InChIKey | UNTKBUBJMICDAE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|