C17H20BrN3O4S — CID 55859299
N'-[2-(3-bromo-2-methylindol-1-yl)acetyl]-2-(1,1-dioxothiolan-3-yl)acetohydrazide (PubChem CID 55859299) has the molecular formula C17H20BrN3O4S and a molecular weight of 442.34 g/mol. Its IUPAC name is N'-[2-(3-bromo-2-methylindol-1-yl)acetyl]-2-(1,1-dioxothiolan-3-yl)acetohydrazide.
| Compound Name | N'-[2-(3-bromo-2-methylindol-1-yl)acetyl]-2-(1,1-dioxothiolan-3-yl)acetohydrazide |
|---|---|
| PubChem CID | 55859299 |
| Molecular Formula | C17H20BrN3O4S |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | N'-[2-(3-bromo-2-methylindol-1-yl)acetyl]-2-(1,1-dioxothiolan-3-yl)acetohydrazide |
| SMILES | Cc1c(Br)c2ccccc2n1CC(=O)NNC(=O)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H20BrN3O4S/c1-11-17(18)13-4-2-3-5-14(13)21(11)9-16(23)20-19-15(22)8-12-6-7-26(24,25)10-12/h2-5,12H,6-10H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | BTZQEHWQLHXHPL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|