C20H17BrN4O2 — CID 55840055
2-(6-bromonaphthalen-2-yl)oxy-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]acetamide (PubChem CID 55840055) has the molecular formula C20H17BrN4O2 and a molecular weight of 425.29 g/mol. Its IUPAC name is 2-(6-bromonaphthalen-2-yl)oxy-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]acetamide.
| Compound Name | 2-(6-bromonaphthalen-2-yl)oxy-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 55840055 |
| Molecular Formula | C20H17BrN4O2 |
| Molecular Weight | 425.29 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 2-(6-bromonaphthalen-2-yl)oxy-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]acetamide |
| SMILES | N#Cc1cccnc1NCCNC(=O)COc1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C20H17BrN4O2/c21-17-5-3-15-11-18(6-4-14(15)10-17)27-13-19(26)23-8-9-25-20-16(12-22)2-1-7-24-20/h1-7,10-11H,8-9,13H2,(H,23,26)(H,24,25) |
| InChIKey | GOTNGWWRDWGZSC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.29 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|