C19H16F3N3O4 — CID 55933517
2-(2-oxochromen-7-yl)oxy-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide (PubChem CID 55933517) has the molecular formula C19H16F3N3O4 and a molecular weight of 407.35 g/mol. Its IUPAC name is 2-(2-oxochromen-7-yl)oxy-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide.
| Compound Name | 2-(2-oxochromen-7-yl)oxy-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 55933517 |
| Molecular Formula | C19H16F3N3O4 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 2-(2-oxochromen-7-yl)oxy-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide |
| SMILES | O=C(COc1ccc2ccc(=O)oc2c1)NCCNc1ncccc1C(F)(F)F |
| InChI | InChI=1S/C19H16F3N3O4/c20-19(21,22)14-2-1-7-24-18(14)25-9-8-23-16(26)11-28-13-5-3-12-4-6-17(27)29-15(12)10-13/h1-7,10H,8-9,11H2,(H,23,26)(H,24,25) |
| InChIKey | VEXISAXXPMFVOT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|