C23H15F3N2O6 — CID 26062108
N-[4-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 26062108) has the molecular formula C23H15F3N2O6 and a molecular weight of 472.38 g/mol. Its IUPAC name is N-[4-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 26062108 |
| Molecular Formula | C23H15F3N2O6 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | N-[4-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(COc1ccc2ccc(=O)oc2c1)Nc1ccc(NC(=O)c2ccco2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H15F3N2O6/c24-23(25,26)16-10-14(27-22(31)18-2-1-9-32-18)5-7-17(16)28-20(29)12-33-15-6-3-13-4-8-21(30)34-19(13)11-15/h1-11H,12H2,(H,27,31)(H,28,29) |
| InChIKey | SAMLZKUQLOALAO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|