C18H18ClN3O3S2 — CID 55492533
N-[3-(1,3-benzothiazol-2-yl)propyl]-2-chloro-5-(methylsulfamoyl)benzamide (PubChem CID 55492533) has the molecular formula C18H18ClN3O3S2 and a molecular weight of 423.95 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)propyl]-2-chloro-5-(methylsulfamoyl)benzamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-2-chloro-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55492533 |
| Molecular Formula | C18H18ClN3O3S2 |
| Molecular Weight | 423.95 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-2-chloro-5-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1ccc(Cl)c(C(=O)NCCCc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C18H18ClN3O3S2/c1-20-27(24,25)12-8-9-14(19)13(11-12)18(23)21-10-4-7-17-22-15-5-2-3-6-16(15)26-17/h2-3,5-6,8-9,11,20H,4,7,10H2,1H3,(H,21,23) |
| InChIKey | UOPQLEZFTVLEPG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.95 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|