C9H11BF2NO4- — CID 53301829
[(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]-trihydroxyboranuide (PubChem CID 53301829) has the molecular formula C9H11BF2NO4- and a molecular weight of 246.00 g/mol. Its IUPAC name is [(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]-trihydroxyboranuide.
| Compound Name | [(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]-trihydroxyboranuide |
|---|---|
| PubChem CID | 53301829 |
| Molecular Formula | C9H11BF2NO4- |
| Molecular Weight | 246.00 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | [(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]-trihydroxyboranuide |
| SMILES | C[C@H](NC(=O)c1c(F)cccc1F)[B-](O)(O)O |
| InChI | InChI=1S/C9H11BF2NO4/c1-5(10(15,16)17)13-9(14)8-6(11)3-2-4-7(8)12/h2-5,15-17H,1H3,(H,13,14)/q-1/t5-/m0/s1 |
| InChIKey | QINJDAAOPMYOAS-YFKPBYRVSA-N |
| XLogP | -0.46 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.00 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|