[(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]boronic acid

C9H10BF2NO3 — CID 53324253

IUPAC[(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]boronic acid
SMILESC[C@H](NC(=O)c1c(F)cccc1F)B(O)O
InChIInChI=1S/C9H10BF2NO3/c1-5(10(15)16)13-9(14)8-6(11)3-2-4-7(8)12/h2-5,15-16H,1H3,(H,13,14)/t5-/m0/s1
InChIKeyQGDLSKBWBZFHDC-YFKPBYRVSA-N
MW228.99 g/mol
LogP0.10
Rot. Bonds3

About [(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]boronic acid

[(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]boronic acid (PubChem CID 53324253) has the molecular formula C9H10BF2NO3 and a molecular weight of 228.99 g/mol. Its IUPAC name is [(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]boronic acid.

Molecular Properties

Compound Name[(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]boronic acid
PubChem CID53324253
Molecular FormulaC9H10BF2NO3
Molecular Weight228.99 g/mol
Exact Mass229.07
IUPAC Name[(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]boronic acid
SMILESC[C@H](NC(=O)c1c(F)cccc1F)B(O)O
InChIInChI=1S/C9H10BF2NO3/c1-5(10(15)16)13-9(14)8-6(11)3-2-4-7(8)12/h2-5,15-16H,1H3,(H,13,14)/t5-/m0/s1
InChIKeyQGDLSKBWBZFHDC-YFKPBYRVSA-N
XLogP0.10
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.99
LogP ≤ 50.10
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]boronic acid?
The IUPAC name of [(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]boronic acid (CID 53324253) is [(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]boronic acid.
What is the SMILES notation for [(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]boronic acid?
The canonical SMILES for [(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]boronic acid is C[C@H](NC(=O)c1c(F)cccc1F)B(O)O.
What is the InChIKey of [(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]boronic acid?
The InChIKey is QGDLSKBWBZFHDC-YFKPBYRVSA-N. The full InChI is InChI=1S/C9H10BF2NO3/c1-5(10(15)16)13-9(14)8-6(11)3-2-4-7(8)12/h2-5,15-16H,1H3,(H,13,14)/t5-/m0/s1.
What are the key properties of [(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]boronic acid?
[(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]boronic acid has a molecular weight of 228.99 g/mol, XLogP of 0.10, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]boronic acid is sourced from PubChem (CID 53324253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).