C9H10BF2NO3 — CID 53324253
[(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]boronic acid (PubChem CID 53324253) has the molecular formula C9H10BF2NO3 and a molecular weight of 228.99 g/mol. Its IUPAC name is [(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]boronic acid.
| Compound Name | [(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 53324253 |
| Molecular Formula | C9H10BF2NO3 |
| Molecular Weight | 228.99 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | [(1R)-1-[(2,6-difluorobenzoyl)amino]ethyl]boronic acid |
| SMILES | C[C@H](NC(=O)c1c(F)cccc1F)B(O)O |
| InChI | InChI=1S/C9H10BF2NO3/c1-5(10(15)16)13-9(14)8-6(11)3-2-4-7(8)12/h2-5,15-16H,1H3,(H,13,14)/t5-/m0/s1 |
| InChIKey | QGDLSKBWBZFHDC-YFKPBYRVSA-N |
| XLogP | 0.10 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.99 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|