C14H21NO3 — CID 103748986
N-heptan-2-yl-2,6-dihydroxybenzamide (PubChem CID 103748986) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is N-heptan-2-yl-2,6-dihydroxybenzamide.
| Compound Name | N-heptan-2-yl-2,6-dihydroxybenzamide |
|---|---|
| PubChem CID | 103748986 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N-heptan-2-yl-2,6-dihydroxybenzamide |
| SMILES | CCCCCC(C)NC(=O)c1c(O)cccc1O |
| InChI | InChI=1S/C14H21NO3/c1-3-4-5-7-10(2)15-14(18)13-11(16)8-6-9-12(13)17/h6,8-10,16-17H,3-5,7H2,1-2H3,(H,15,18) |
| InChIKey | CWMHWFCHLCHPLZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|