C18H22Cl2N2O2 — CID 4618388
3-(2,6-dichlorophenyl)-N-heptan-2-yl-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 4618388) has the molecular formula C18H22Cl2N2O2 and a molecular weight of 369.29 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-N-heptan-2-yl-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2,6-dichlorophenyl)-N-heptan-2-yl-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 4618388 |
| Molecular Formula | C18H22Cl2N2O2 |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-N-heptan-2-yl-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | CCCCCC(C)NC(=O)c1c(-c2c(Cl)cccc2Cl)noc1C |
| InChI | InChI=1S/C18H22Cl2N2O2/c1-4-5-6-8-11(2)21-18(23)15-12(3)24-22-17(15)16-13(19)9-7-10-14(16)20/h7,9-11H,4-6,8H2,1-3H3,(H,21,23) |
| InChIKey | FGIOTAKEHYOZJB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|