C13H22N2O — CID 102603550
N-heptan-2-yl-1-methylpyrrole-2-carboxamide (PubChem CID 102603550) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is N-heptan-2-yl-1-methylpyrrole-2-carboxamide.
| Compound Name | N-heptan-2-yl-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 102603550 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N-heptan-2-yl-1-methylpyrrole-2-carboxamide |
| SMILES | CCCCCC(C)NC(=O)c1cccn1C |
| InChI | InChI=1S/C13H22N2O/c1-4-5-6-8-11(2)14-13(16)12-9-7-10-15(12)3/h7,9-11H,4-6,8H2,1-3H3,(H,14,16) |
| InChIKey | RGLVIOHRWBQTHC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|