C12H22ClN3O — CID 119588537
N-(1-amino-4-methylpentan-2-yl)-1-methylpyrrole-2-carboxamide;hydrochloride (PubChem CID 119588537) has the molecular formula C12H22ClN3O and a molecular weight of 259.78 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-1-methylpyrrole-2-carboxamide;hydrochloride.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-1-methylpyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119588537 |
| Molecular Formula | C12H22ClN3O |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-1-methylpyrrole-2-carboxamide;hydrochloride |
| SMILES | CC(C)CC(CN)NC(=O)c1cccn1C.Cl |
| InChI | InChI=1S/C12H21N3O.ClH/c1-9(2)7-10(8-13)14-12(16)11-5-4-6-15(11)3;/h4-6,9-10H,7-8,13H2,1-3H3,(H,14,16);1H |
| InChIKey | BWTMLBDWUKFYTM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |