C9H14N4OS — CID 107972197
N-(4-amino-4-sulfanylidenebutan-2-yl)-1-methylimidazole-4-carboxamide (PubChem CID 107972197) has the molecular formula C9H14N4OS and a molecular weight of 226.31 g/mol. Its IUPAC name is N-(4-amino-4-sulfanylidenebutan-2-yl)-1-methylimidazole-4-carboxamide.
| Compound Name | N-(4-amino-4-sulfanylidenebutan-2-yl)-1-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 107972197 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.31 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | N-(4-amino-4-sulfanylidenebutan-2-yl)-1-methylimidazole-4-carboxamide |
| SMILES | CC(CC(N)=S)NC(=O)c1cn(C)cn1 |
| InChI | InChI=1S/C9H14N4OS/c1-6(3-8(10)15)12-9(14)7-4-13(2)5-11-7/h4-6H,3H2,1-2H3,(H2,10,15)(H,12,14) |
| InChIKey | WQJXITBNBCGHPO-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|