C9H12N4O4 — CID 107971770
(2R)-4-amino-2-[(1-methylimidazole-4-carbonyl)amino]-4-oxobutanoic acid (PubChem CID 107971770) has the molecular formula C9H12N4O4 and a molecular weight of 240.22 g/mol. Its IUPAC name is (2R)-4-amino-2-[(1-methylimidazole-4-carbonyl)amino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-[(1-methylimidazole-4-carbonyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107971770 |
| Molecular Formula | C9H12N4O4 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | (2R)-4-amino-2-[(1-methylimidazole-4-carbonyl)amino]-4-oxobutanoic acid |
| SMILES | Cn1cnc(C(=O)N[C@H](CC(N)=O)C(=O)O)c1 |
| InChI | InChI=1S/C9H12N4O4/c1-13-3-6(11-4-13)8(15)12-5(9(16)17)2-7(10)14/h3-5H,2H2,1H3,(H2,10,14)(H,12,15)(H,16,17)/t5-/m1/s1 |
| InChIKey | WXJFCGGLFREZBE-RXMQYKEDSA-N |
| XLogP | -1.52 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |