C10H12N4O5 — CID 61142499
(2S)-4-amino-2-[(1-methyl-6-oxopyridazine-3-carbonyl)amino]-4-oxobutanoic acid (PubChem CID 61142499) has the molecular formula C10H12N4O5 and a molecular weight of 268.23 g/mol. Its IUPAC name is (2S)-4-amino-2-[(1-methyl-6-oxopyridazine-3-carbonyl)amino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[(1-methyl-6-oxopyridazine-3-carbonyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 61142499 |
| Molecular Formula | C10H12N4O5 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | (2S)-4-amino-2-[(1-methyl-6-oxopyridazine-3-carbonyl)amino]-4-oxobutanoic acid |
| SMILES | Cn1nc(C(=O)N[C@@H](CC(N)=O)C(=O)O)ccc1=O |
| InChI | InChI=1S/C10H12N4O5/c1-14-8(16)3-2-5(13-14)9(17)12-6(10(18)19)4-7(11)15/h2-3,6H,4H2,1H3,(H2,11,15)(H,12,17)(H,18,19)/t6-/m0/s1 |
| InChIKey | BGOSEWYEXUHPON-LURJTMIESA-N |
| XLogP | -2.16 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |