C10H15N3O3S — CID 107971719
(2R)-2-[(1-methylimidazole-4-carbonyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 107971719) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is (2R)-2-[(1-methylimidazole-4-carbonyl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[(1-methylimidazole-4-carbonyl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 107971719 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | (2R)-2-[(1-methylimidazole-4-carbonyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NC(=O)c1cn(C)cn1)C(=O)O |
| InChI | InChI=1S/C10H15N3O3S/c1-13-5-8(11-6-13)9(14)12-7(10(15)16)3-4-17-2/h5-7H,3-4H2,1-2H3,(H,12,14)(H,15,16)/t7-/m1/s1 |
| InChIKey | ZFUPHLNCSPOUSZ-SSDOTTSWSA-N |
| XLogP | 0.36 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |