C11H16N4O5 — CID 107497570
(2S)-2-[[1-(2-aminoethyl)imidazole-4-carbonyl]amino]pentanedioic acid (PubChem CID 107497570) has the molecular formula C11H16N4O5 and a molecular weight of 284.27 g/mol. Its IUPAC name is (2S)-2-[[1-(2-aminoethyl)imidazole-4-carbonyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[1-(2-aminoethyl)imidazole-4-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 107497570 |
| Molecular Formula | C11H16N4O5 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | (2S)-2-[[1-(2-aminoethyl)imidazole-4-carbonyl]amino]pentanedioic acid |
| SMILES | NCCn1cnc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)c1 |
| InChI | InChI=1S/C11H16N4O5/c12-3-4-15-5-8(13-6-15)10(18)14-7(11(19)20)1-2-9(16)17/h5-7H,1-4,12H2,(H,14,18)(H,16,17)(H,19,20)/t7-/m0/s1 |
| InChIKey | UVRNPMHSKVJELI-ZETCQYMHSA-N |
| XLogP | -1.11 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |