C11H18N4O5S — CID 107497485
2-[[1-(2-aminoethyl)imidazole-4-carbonyl]amino]-4-methylsulfonylbutanoic acid (PubChem CID 107497485) has the molecular formula C11H18N4O5S and a molecular weight of 318.36 g/mol. Its IUPAC name is 2-[[1-(2-aminoethyl)imidazole-4-carbonyl]amino]-4-methylsulfonylbutanoic acid.
| Compound Name | 2-[[1-(2-aminoethyl)imidazole-4-carbonyl]amino]-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 107497485 |
| Molecular Formula | C11H18N4O5S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2-[[1-(2-aminoethyl)imidazole-4-carbonyl]amino]-4-methylsulfonylbutanoic acid |
| SMILES | CS(=O)(=O)CCC(NC(=O)c1cn(CCN)cn1)C(=O)O |
| InChI | InChI=1S/C11H18N4O5S/c1-21(19,20)5-2-8(11(17)18)14-10(16)9-6-15(4-3-12)7-13-9/h6-8H,2-5,12H2,1H3,(H,14,16)(H,17,18) |
| InChIKey | ZLAQVVOWOWCWNV-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |