C14H24N4O3 — CID 107499022
3-[[[1-(2-aminoethyl)imidazole-4-carbonyl]amino]methyl]-5-methylhexanoic acid (PubChem CID 107499022) has the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-[[[1-(2-aminoethyl)imidazole-4-carbonyl]amino]methyl]-5-methylhexanoic acid.
| Compound Name | 3-[[[1-(2-aminoethyl)imidazole-4-carbonyl]amino]methyl]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 107499022 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 3-[[[1-(2-aminoethyl)imidazole-4-carbonyl]amino]methyl]-5-methylhexanoic acid |
| SMILES | CC(C)CC(CNC(=O)c1cn(CCN)cn1)CC(=O)O |
| InChI | InChI=1S/C14H24N4O3/c1-10(2)5-11(6-13(19)20)7-16-14(21)12-8-18(4-3-15)9-17-12/h8-11H,3-7,15H2,1-2H3,(H,16,21)(H,19,20) |
| InChIKey | LSNDOJVCRUPKOC-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |