C12H15BrN4OS — CID 122144246
N-[4-(4-bromopyrazol-1-yl)butyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 122144246) has the molecular formula C12H15BrN4OS and a molecular weight of 343.25 g/mol. Its IUPAC name is N-[4-(4-bromopyrazol-1-yl)butyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[4-(4-bromopyrazol-1-yl)butyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 122144246 |
| Molecular Formula | C12H15BrN4OS |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | N-[4-(4-bromopyrazol-1-yl)butyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncsc1C(=O)NCCCCn1cc(Br)cn1 |
| InChI | InChI=1S/C12H15BrN4OS/c1-9-11(19-8-15-9)12(18)14-4-2-3-5-17-7-10(13)6-16-17/h6-8H,2-5H2,1H3,(H,14,18) |
| InChIKey | OTJUCDXNAFOEOL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|